C24H36O6 — CID 91193780
bis(2-octa-2,7-dienoxyethyl) but-2-enedioate (PubChem CID 91193780) has the molecular formula C24H36O6 and a molecular weight of 420.55 g/mol. Its IUPAC name is bis(2-octa-2,7-dienoxyethyl) but-2-enedioate.
| Compound Name | bis(2-octa-2,7-dienoxyethyl) but-2-enedioate |
|---|---|
| PubChem CID | 91193780 |
| Molecular Formula | C24H36O6 |
| Molecular Weight | 420.55 g/mol |
| Exact Mass | 420.25 |
| IUPAC Name | bis(2-octa-2,7-dienoxyethyl) but-2-enedioate |
| SMILES | C=CCCCC=CCOCCOC(=O)C=CC(=O)OCCOCC=CCCCC=C |
| InChI | InChI=1S/C24H36O6/c1-3-5-7-9-11-13-17-27-19-21-29-23(25)15-16-24(26)30-22-20-28-18-14-12-10-8-6-4-2/h3-4,11-16H,1-2,5-10,17-22H2 |
| InChIKey | SBEVJXDGYYIKIB-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.55 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|