C38H45FN6O2Si — CID 91193940
3-[2-ethyl-1-isoquinolin-3-yl-2-[7-methyl-2-(2-trimethylsilylethoxymethyl)indazol-5-yl]piperidin-4-yl]-8-fluoro-1,4-dihydroquinazolin-2-one (PubChem CID 91193940) has the molecular formula C38H45FN6O2Si and a molecular weight of 664.90 g/mol. Its IUPAC name is 3-[2-ethyl-1-isoquinolin-3-yl-2-[7-methyl-2-(2-trimethylsilylethoxymethyl)indazol-5-yl]piperidin-4-yl]-8-fluoro-1,4-dihydroquinazolin-2-one.
| Compound Name | 3-[2-ethyl-1-isoquinolin-3-yl-2-[7-methyl-2-(2-trimethylsilylethoxymethyl)indazol-5-yl]piperidin-4-yl]-8-fluoro-1,4-dihydroquinazolin-2-one |
|---|---|
| PubChem CID | 91193940 |
| Molecular Formula | C38H45FN6O2Si |
| Molecular Weight | 664.90 g/mol |
| Exact Mass | 664.34 |
| IUPAC Name | 3-[2-ethyl-1-isoquinolin-3-yl-2-[7-methyl-2-(2-trimethylsilylethoxymethyl)indazol-5-yl]piperidin-4-yl]-8-fluoro-1,4-dihydroquinazolin-2-one |
| SMILES | CCC1(c2cc(C)c3nn(COCC[Si](C)(C)C)cc3c2)CC(N2Cc3cccc(F)c3NC2=O)CCN1c1cc2ccccc2cn1 |
| InChI | InChI=1S/C38H45FN6O2Si/c1-6-38(31-18-26(2)35-30(19-31)23-43(42-35)25-47-16-17-48(3,4)5)21-32(44-24-29-12-9-13-33(39)36(29)41-37(44)46)14-15-45(38)34-20-27-10-7-8-11-28(27)22-40-34/h7-13,18-20,22-23,32H,6,14-17,21,24-25H2,1-5H3,(H,41,46) |
| InChIKey | WYBZZPZQZQLLQU-UHFFFAOYSA-N |
| XLogP | 8.67 |
| TPSA | 75.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 664.90 |
| LogP ≤ 5 | 8.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|