About 2-hydroxy-N,N-dimethyl-5-[[[4-(1,3-oxazol-5-yl)phenyl]diazenyl]methyl]benzamide
2-hydroxy-N,N-dimethyl-5-[[[4-(1,3-oxazol-5-yl)phenyl]diazenyl]methyl]benzamide (PubChem CID 91194053) has the molecular formula C19H18N4O3
and a molecular weight of 350.38 g/mol. Its IUPAC name is 2-hydroxy-N,N-dimethyl-5-[[[4-(1,3-oxazol-5-yl)phenyl]diazenyl]methyl]benzamide.
Molecular Properties
| Compound Name | 2-hydroxy-N,N-dimethyl-5-[[[4-(1,3-oxazol-5-yl)phenyl]diazenyl]methyl]benzamide |
| PubChem CID | 91194053 |
| Molecular Formula | C19H18N4O3 |
| Molecular Weight | 350.38 g/mol |
| Exact Mass | 350.14 |
| IUPAC Name | 2-hydroxy-N,N-dimethyl-5-[[[4-(1,3-oxazol-5-yl)phenyl]diazenyl]methyl]benzamide |
| SMILES | CN(C)C(=O)c1cc(C/N=N/c2ccc(-c3cnco3)cc2)ccc1O |
| InChI | InChI=1S/C19H18N4O3/c1-23(2)19(25)16-9-13(3-8-17(16)24)10-21-22-15-6-4-14(5-7-15)18-11-20-12-26-18/h3-9,11-12,24H,10H2,1-2H3/b22-21+ |
| InChIKey | GKWGKDUAHHZECN-QURGRASLSA-N |
| XLogP | 4.03 |
| TPSA | 91.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 350.38 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|
Analyze 2-hydroxy-N,N-dimethyl-5-[[[4-(1,3-oxazol-5-yl)phenyl]diazenyl]methyl]benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-hydroxy-N,N-dimethyl-5-[[[4-(1,3-oxazol-5-yl)phenyl]diazenyl]methyl]benzamide?
The IUPAC name of 2-hydroxy-N,N-dimethyl-5-[[[4-(1,3-oxazol-5-yl)phenyl]diazenyl]methyl]benzamide (CID 91194053) is 2-hydroxy-N,N-dimethyl-5-[[[4-(1,3-oxazol-5-yl)phenyl]diazenyl]methyl]benzamide.
What is the SMILES notation for 2-hydroxy-N,N-dimethyl-5-[[[4-(1,3-oxazol-5-yl)phenyl]diazenyl]methyl]benzamide?
The canonical SMILES for 2-hydroxy-N,N-dimethyl-5-[[[4-(1,3-oxazol-5-yl)phenyl]diazenyl]methyl]benzamide is CN(C)C(=O)c1cc(C/N=N/c2ccc(-c3cnco3)cc2)ccc1O.
What is the InChIKey of 2-hydroxy-N,N-dimethyl-5-[[[4-(1,3-oxazol-5-yl)phenyl]diazenyl]methyl]benzamide?
The InChIKey is GKWGKDUAHHZECN-QURGRASLSA-N. The full InChI is InChI=1S/C19H18N4O3/c1-23(2)19(25)16-9-13(3-8-17(16)24)10-21-22-15-6-4-14(5-7-15)18-11-20-12-26-18/h3-9,11-12,24H,10H2,1-2H3/b22-21+.
What are the key properties of 2-hydroxy-N,N-dimethyl-5-[[[4-(1,3-oxazol-5-yl)phenyl]diazenyl]methyl]benzamide?
2-hydroxy-N,N-dimethyl-5-[[[4-(1,3-oxazol-5-yl)phenyl]diazenyl]methyl]benzamide has a molecular weight of 350.38 g/mol, XLogP of 4.03, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hydroxy-N,N-dimethyl-5-[[[4-(1,3-oxazol-5-yl)phenyl]diazenyl]methyl]benzamide is sourced from PubChem (CID 91194053), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).