C16H14N4S2 — CID 911948
(1S,5S)-1,5-diphenyl-1,2,5,6-tetrahydro-[1,2,4]triazolo[1,2-a][1,2,4]triazole-3,7-dithione (PubChem CID 911948) has the molecular formula C16H14N4S2 and a molecular weight of 326.45 g/mol. Its IUPAC name is (1S,5S)-1,5-diphenyl-1,2,5,6-tetrahydro-[1,2,4]triazolo[1,2-a][1,2,4]triazole-3,7-dithione.
| Compound Name | (1S,5S)-1,5-diphenyl-1,2,5,6-tetrahydro-[1,2,4]triazolo[1,2-a][1,2,4]triazole-3,7-dithione |
|---|---|
| PubChem CID | 911948 |
| Molecular Formula | C16H14N4S2 |
| Molecular Weight | 326.45 g/mol |
| Exact Mass | 326.07 |
| IUPAC Name | (1S,5S)-1,5-diphenyl-1,2,5,6-tetrahydro-[1,2,4]triazolo[1,2-a][1,2,4]triazole-3,7-dithione |
| SMILES | S=C1N[C@H](c2ccccc2)N2C(=S)N[C@H](c3ccccc3)N12 |
| InChI | InChI=1S/C16H14N4S2/c21-15-17-13(11-7-3-1-4-8-11)19-16(22)18-14(20(15)19)12-9-5-2-6-10-12/h1-10,13-14H,(H,17,21)(H,18,22)/t13-,14-/m0/s1 |
| InChIKey | LRGBKQAXMKYMHJ-KBPBESRZSA-N |
| XLogP | 2.68 |
| TPSA | 30.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.45 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|