C21H23F3N2O6S2 — CID 91194910
N,N-dimethyl-4-[5-methyl-4-(4-methylsulfonylphenyl)-1,2-oxazol-3-yl]aniline;methyl trifluoromethanesulfonate (PubChem CID 91194910) has the molecular formula C21H23F3N2O6S2 and a molecular weight of 520.55 g/mol. Its IUPAC name is N,N-dimethyl-4-[5-methyl-4-(4-methylsulfonylphenyl)-1,2-oxazol-3-yl]aniline;methyl trifluoromethanesulfonate.
| Compound Name | N,N-dimethyl-4-[5-methyl-4-(4-methylsulfonylphenyl)-1,2-oxazol-3-yl]aniline;methyl trifluoromethanesulfonate |
|---|---|
| PubChem CID | 91194910 |
| Molecular Formula | C21H23F3N2O6S2 |
| Molecular Weight | 520.55 g/mol |
| Exact Mass | 520.09 |
| IUPAC Name | N,N-dimethyl-4-[5-methyl-4-(4-methylsulfonylphenyl)-1,2-oxazol-3-yl]aniline;methyl trifluoromethanesulfonate |
| SMILES | COS(=O)(=O)C(F)(F)F.Cc1onc(-c2ccc(N(C)C)cc2)c1-c1ccc(S(C)(=O)=O)cc1 |
| InChI | InChI=1S/C19H20N2O3S.C2H3F3O3S/c1-13-18(14-7-11-17(12-8-14)25(4,22)23)19(20-24-13)15-5-9-16(10-6-15)21(2)3;1-8-9(6,7)2(3,4)5/h5-12H,1-4H3;1H3 |
| InChIKey | LOGCJEJFAHOMCH-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 106.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.55 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|