About 1-[(4-hydroxy-2-methyloctan-3-yl)amino]butane-1,3-diol
1-[(4-hydroxy-2-methyloctan-3-yl)amino]butane-1,3-diol (PubChem CID 91194963) has the molecular formula C13H28NO3+
and a molecular weight of 246.37 g/mol. Its IUPAC name is 1-[(4-hydroxy-2-methyloctan-3-yl)amino]butane-1,3-diol.
Molecular Properties
| Compound Name | 1-[(4-hydroxy-2-methyloctan-3-yl)amino]butane-1,3-diol |
| PubChem CID | 91194963 |
| Molecular Formula | C13H28NO3+ |
| Molecular Weight | 246.37 g/mol |
| Exact Mass | 246.21 |
| IUPAC Name | 1-[(4-hydroxy-2-methyloctan-3-yl)amino]butane-1,3-diol |
| SMILES | CCC[CH+]C(O)C(NC(O)CC(C)O)C(C)C |
| InChI | InChI=1S/C13H28NO3/c1-5-6-7-11(16)13(9(2)3)14-12(17)8-10(4)15/h7,9-17H,5-6,8H2,1-4H3/q+1 |
| InChIKey | PRDJETXGMBVSSJ-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 72.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.37 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 1-[(4-hydroxy-2-methyloctan-3-yl)amino]butane-1,3-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(4-hydroxy-2-methyloctan-3-yl)amino]butane-1,3-diol?
The IUPAC name of 1-[(4-hydroxy-2-methyloctan-3-yl)amino]butane-1,3-diol (CID 91194963) is 1-[(4-hydroxy-2-methyloctan-3-yl)amino]butane-1,3-diol.
What is the SMILES notation for 1-[(4-hydroxy-2-methyloctan-3-yl)amino]butane-1,3-diol?
The canonical SMILES for 1-[(4-hydroxy-2-methyloctan-3-yl)amino]butane-1,3-diol is CCC[CH+]C(O)C(NC(O)CC(C)O)C(C)C.
What is the InChIKey of 1-[(4-hydroxy-2-methyloctan-3-yl)amino]butane-1,3-diol?
The InChIKey is PRDJETXGMBVSSJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H28NO3/c1-5-6-7-11(16)13(9(2)3)14-12(17)8-10(4)15/h7,9-17H,5-6,8H2,1-4H3/q+1.
What are the key properties of 1-[(4-hydroxy-2-methyloctan-3-yl)amino]butane-1,3-diol?
1-[(4-hydroxy-2-methyloctan-3-yl)amino]butane-1,3-diol has a molecular weight of 246.37 g/mol, XLogP of 1.06, 9 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(4-hydroxy-2-methyloctan-3-yl)amino]butane-1,3-diol is sourced from PubChem (CID 91194963), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).