About 10-methyl-9-methylidene-8H-pyrrolo[2,3-d]azonine
10-methyl-9-methylidene-8H-pyrrolo[2,3-d]azonine (PubChem CID 91195157) has the molecular formula C12H12N2
and a molecular weight of 184.24 g/mol. Its IUPAC name is 10-methyl-9-methylidene-8H-pyrrolo[2,3-d]azonine.
Molecular Properties
| Compound Name | 10-methyl-9-methylidene-8H-pyrrolo[2,3-d]azonine |
| PubChem CID | 91195157 |
| Molecular Formula | C12H12N2 |
| Molecular Weight | 184.24 g/mol |
| Exact Mass | 184.10 |
| IUPAC Name | 10-methyl-9-methylidene-8H-pyrrolo[2,3-d]azonine |
| SMILES | C=c1[nH]ccccc2c(c1C)N=CC=2 |
| InChI | InChI=1S/C12H12N2/c1-9-10(2)13-7-4-3-5-11-6-8-14-12(9)11/h3-8,13H,2H2,1H3/b5-3-,7-4-,12-9+ |
| InChIKey | RSFJTYZBVHCCLL-JNDVQRNCSA-N |
| XLogP | 1.35 |
| TPSA | 28.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.24 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 10-methyl-9-methylidene-8H-pyrrolo[2,3-d]azonine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 10-methyl-9-methylidene-8H-pyrrolo[2,3-d]azonine?
The IUPAC name of 10-methyl-9-methylidene-8H-pyrrolo[2,3-d]azonine (CID 91195157) is 10-methyl-9-methylidene-8H-pyrrolo[2,3-d]azonine.
What is the SMILES notation for 10-methyl-9-methylidene-8H-pyrrolo[2,3-d]azonine?
The canonical SMILES for 10-methyl-9-methylidene-8H-pyrrolo[2,3-d]azonine is C=c1[nH]ccccc2c(c1C)N=CC=2.
What is the InChIKey of 10-methyl-9-methylidene-8H-pyrrolo[2,3-d]azonine?
The InChIKey is RSFJTYZBVHCCLL-JNDVQRNCSA-N. The full InChI is InChI=1S/C12H12N2/c1-9-10(2)13-7-4-3-5-11-6-8-14-12(9)11/h3-8,13H,2H2,1H3/b5-3-,7-4-,12-9+.
What are the key properties of 10-methyl-9-methylidene-8H-pyrrolo[2,3-d]azonine?
10-methyl-9-methylidene-8H-pyrrolo[2,3-d]azonine has a molecular weight of 184.24 g/mol, XLogP of 1.35, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 10-methyl-9-methylidene-8H-pyrrolo[2,3-d]azonine is sourced from PubChem (CID 91195157), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).