C18H24N2O3 — CID 91195390
ethane;methyl 6-benzamidopyridine-3-carboxylate (PubChem CID 91195390) has the molecular formula C18H24N2O3 and a molecular weight of 316.40 g/mol. Its IUPAC name is ethane;methyl 6-benzamidopyridine-3-carboxylate.
| Compound Name | ethane;methyl 6-benzamidopyridine-3-carboxylate |
|---|---|
| PubChem CID | 91195390 |
| Molecular Formula | C18H24N2O3 |
| Molecular Weight | 316.40 g/mol |
| Exact Mass | 316.18 |
| IUPAC Name | ethane;methyl 6-benzamidopyridine-3-carboxylate |
| SMILES | CC.CC.COC(=O)c1ccc(NC(=O)c2ccccc2)nc1 |
| InChI | InChI=1S/C14H12N2O3.2C2H6/c1-19-14(18)11-7-8-12(15-9-11)16-13(17)10-5-3-2-4-6-10;2*1-2/h2-9H,1H3,(H,15,16,17);2*1-2H3 |
| InChIKey | OGGWSFPDLVPAEG-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.40 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |