C18H32FN3 — CID 91195443
4,5-diethyl-7-(6-fluorohepta-2,4,6-trien-3-yl)-N,5-dimethyl-1,3-diazepan-2-amine (PubChem CID 91195443) has the molecular formula C18H32FN3 and a molecular weight of 309.47 g/mol. Its IUPAC name is 4,5-diethyl-7-(6-fluorohepta-2,4,6-trien-3-yl)-N,5-dimethyl-1,3-diazepan-2-amine.
| Compound Name | 4,5-diethyl-7-(6-fluorohepta-2,4,6-trien-3-yl)-N,5-dimethyl-1,3-diazepan-2-amine |
|---|---|
| PubChem CID | 91195443 |
| Molecular Formula | C18H32FN3 |
| Molecular Weight | 309.47 g/mol |
| Exact Mass | 309.26 |
| IUPAC Name | 4,5-diethyl-7-(6-fluorohepta-2,4,6-trien-3-yl)-N,5-dimethyl-1,3-diazepan-2-amine |
| SMILES | C=C(F)C=CC(=CC)C1CC(C)(CC)C(CC)NC(NC)N1 |
| InChI | InChI=1S/C18H32FN3/c1-7-14(11-10-13(4)19)15-12-18(5,9-3)16(8-2)22-17(20-6)21-15/h7,10-11,15-17,20-22H,4,8-9,12H2,1-3,5-6H3 |
| InChIKey | FPWUWDGUGVYJBJ-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 36.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.47 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|