About 1,6-dimethyl-6-propan-2-yl-2,3-dihydropyridin-3-amine
1,6-dimethyl-6-propan-2-yl-2,3-dihydropyridin-3-amine (PubChem CID 91195489) has the molecular formula C10H20N2
and a molecular weight of 168.28 g/mol. Its IUPAC name is 1,6-dimethyl-6-propan-2-yl-2,3-dihydropyridin-3-amine.
Molecular Properties
| Compound Name | 1,6-dimethyl-6-propan-2-yl-2,3-dihydropyridin-3-amine |
| PubChem CID | 91195489 |
| Molecular Formula | C10H20N2 |
| Molecular Weight | 168.28 g/mol |
| Exact Mass | 168.16 |
| IUPAC Name | 1,6-dimethyl-6-propan-2-yl-2,3-dihydropyridin-3-amine |
| SMILES | CC(C)C1(C)C=CC(N)CN1C |
| InChI | InChI=1S/C10H20N2/c1-8(2)10(3)6-5-9(11)7-12(10)4/h5-6,8-9H,7,11H2,1-4H3 |
| InChIKey | ZTDLCRPNNUEABL-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 168.28 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1,6-dimethyl-6-propan-2-yl-2,3-dihydropyridin-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,6-dimethyl-6-propan-2-yl-2,3-dihydropyridin-3-amine?
The IUPAC name of 1,6-dimethyl-6-propan-2-yl-2,3-dihydropyridin-3-amine (CID 91195489) is 1,6-dimethyl-6-propan-2-yl-2,3-dihydropyridin-3-amine.
What is the SMILES notation for 1,6-dimethyl-6-propan-2-yl-2,3-dihydropyridin-3-amine?
The canonical SMILES for 1,6-dimethyl-6-propan-2-yl-2,3-dihydropyridin-3-amine is CC(C)C1(C)C=CC(N)CN1C.
What is the InChIKey of 1,6-dimethyl-6-propan-2-yl-2,3-dihydropyridin-3-amine?
The InChIKey is ZTDLCRPNNUEABL-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H20N2/c1-8(2)10(3)6-5-9(11)7-12(10)4/h5-6,8-9H,7,11H2,1-4H3.
What are the key properties of 1,6-dimethyl-6-propan-2-yl-2,3-dihydropyridin-3-amine?
1,6-dimethyl-6-propan-2-yl-2,3-dihydropyridin-3-amine has a molecular weight of 168.28 g/mol, XLogP of 1.23, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1,6-dimethyl-6-propan-2-yl-2,3-dihydropyridin-3-amine is sourced from PubChem (CID 91195489), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).