C17H31N — CID 91195542
N,3,4,6-tetramethyl-3,6-bis(prop-1-en-2-yl)cycloheptan-1-amine (PubChem CID 91195542) has the molecular formula C17H31N and a molecular weight of 249.44 g/mol. Its IUPAC name is N,3,4,6-tetramethyl-3,6-bis(prop-1-en-2-yl)cycloheptan-1-amine.
| Compound Name | N,3,4,6-tetramethyl-3,6-bis(prop-1-en-2-yl)cycloheptan-1-amine |
|---|---|
| PubChem CID | 91195542 |
| Molecular Formula | C17H31N |
| Molecular Weight | 249.44 g/mol |
| Exact Mass | 249.25 |
| IUPAC Name | N,3,4,6-tetramethyl-3,6-bis(prop-1-en-2-yl)cycloheptan-1-amine |
| SMILES | C=C(C)C1(C)CC(NC)CC(C)(C(=C)C)C(C)C1 |
| InChI | InChI=1S/C17H31N/c1-12(2)16(6)9-14(5)17(7,13(3)4)11-15(10-16)18-8/h14-15,18H,1,3,9-11H2,2,4-8H3 |
| InChIKey | KIFPICZTEGNXNG-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.44 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|