About nonadec-4-ene-1,3-diol
nonadec-4-ene-1,3-diol (PubChem CID 91196068) has the molecular formula C19H38O2
and a molecular weight of 298.51 g/mol. Its IUPAC name is nonadec-4-ene-1,3-diol.
Molecular Properties
| Compound Name | nonadec-4-ene-1,3-diol |
| PubChem CID | 91196068 |
| Molecular Formula | C19H38O2 |
| Molecular Weight | 298.51 g/mol |
| Exact Mass | 298.29 |
| IUPAC Name | nonadec-4-ene-1,3-diol |
| SMILES | CCCCCCCCCCCCCCC=CC(O)CCO |
| InChI | InChI=1S/C19H38O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-19(21)17-18-20/h15-16,19-21H,2-14,17-18H2,1H3 |
| InChIKey | USFFZEYYHJQGGI-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 298.51 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze nonadec-4-ene-1,3-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of nonadec-4-ene-1,3-diol?
The IUPAC name of nonadec-4-ene-1,3-diol (CID 91196068) is nonadec-4-ene-1,3-diol.
What is the SMILES notation for nonadec-4-ene-1,3-diol?
The canonical SMILES for nonadec-4-ene-1,3-diol is CCCCCCCCCCCCCCC=CC(O)CCO.
What is the InChIKey of nonadec-4-ene-1,3-diol?
The InChIKey is USFFZEYYHJQGGI-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H38O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-19(21)17-18-20/h15-16,19-21H,2-14,17-18H2,1H3.
What are the key properties of nonadec-4-ene-1,3-diol?
nonadec-4-ene-1,3-diol has a molecular weight of 298.51 g/mol, XLogP of 5.38, 16 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for nonadec-4-ene-1,3-diol is sourced from PubChem (CID 91196068), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).