C9H14N2 — CID 91196503
2,3,4,4a,5,9a-hexahydro-1H-pyrido[2,3-b]azepine (PubChem CID 91196503) has the molecular formula C9H14N2 and a molecular weight of 150.23 g/mol. Its IUPAC name is 2,3,4,4a,5,9a-hexahydro-1H-pyrido[2,3-b]azepine.
| Compound Name | 2,3,4,4a,5,9a-hexahydro-1H-pyrido[2,3-b]azepine |
|---|---|
| PubChem CID | 91196503 |
| Molecular Formula | C9H14N2 |
| Molecular Weight | 150.23 g/mol |
| Exact Mass | 150.12 |
| IUPAC Name | 2,3,4,4a,5,9a-hexahydro-1H-pyrido[2,3-b]azepine |
| SMILES | C1=CCC2CCCNC2N=C1 |
| InChI | InChI=1S/C9H14N2/c1-2-6-10-9-8(4-1)5-3-7-11-9/h1-2,6,8-9,11H,3-5,7H2 |
| InChIKey | KHZNRUBAABARFC-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 150.23 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |