C20H17BrN3O+ — CID 91196748
2-(3-bromophenyl)-5-(2-phenoxyethyl)-3H-imidazo[4,5-c]pyridin-5-ium (PubChem CID 91196748) has the molecular formula C20H17BrN3O+ and a molecular weight of 395.28 g/mol. Its IUPAC name is 2-(3-bromophenyl)-5-(2-phenoxyethyl)-3H-imidazo[4,5-c]pyridin-5-ium.
| Compound Name | 2-(3-bromophenyl)-5-(2-phenoxyethyl)-3H-imidazo[4,5-c]pyridin-5-ium |
|---|---|
| PubChem CID | 91196748 |
| Molecular Formula | C20H17BrN3O+ |
| Molecular Weight | 395.28 g/mol |
| Exact Mass | 394.05 |
| IUPAC Name | 2-(3-bromophenyl)-5-(2-phenoxyethyl)-3H-imidazo[4,5-c]pyridin-5-ium |
| SMILES | Brc1cccc(-c2nc3cc[n+](CCOc4ccccc4)cc3[nH]2)c1 |
| InChI | InChI=1S/C20H16BrN3O/c21-16-6-4-5-15(13-16)20-22-18-9-10-24(14-19(18)23-20)11-12-25-17-7-2-1-3-8-17/h1-10,13-14H,11-12H2/p+1 |
| InChIKey | FRPXEPNMRNUTFN-UHFFFAOYSA-O |
| XLogP | 4.36 |
| TPSA | 41.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.28 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|