About 4-[[2-(2-ethylanilino)-1,3-benzoxazol-5-yl]oxymethyl]pyridine-2-carboxamide
4-[[2-(2-ethylanilino)-1,3-benzoxazol-5-yl]oxymethyl]pyridine-2-carboxamide (PubChem CID 91196797) has the molecular formula C22H20N4O3
and a molecular weight of 388.43 g/mol. Its IUPAC name is 4-[[2-(2-ethylanilino)-1,3-benzoxazol-5-yl]oxymethyl]pyridine-2-carboxamide.
Molecular Properties
| Compound Name | 4-[[2-(2-ethylanilino)-1,3-benzoxazol-5-yl]oxymethyl]pyridine-2-carboxamide |
| PubChem CID | 91196797 |
| Molecular Formula | C22H20N4O3 |
| Molecular Weight | 388.43 g/mol |
| Exact Mass | 388.15 |
| IUPAC Name | 4-[[2-(2-ethylanilino)-1,3-benzoxazol-5-yl]oxymethyl]pyridine-2-carboxamide |
| SMILES | CCc1ccccc1Nc1nc2cc(OCc3ccnc(C(N)=O)c3)ccc2o1 |
| InChI | InChI=1S/C22H20N4O3/c1-2-15-5-3-4-6-17(15)25-22-26-18-12-16(7-8-20(18)29-22)28-13-14-9-10-24-19(11-14)21(23)27/h3-12H,2,13H2,1H3,(H2,23,27)(H,25,26) |
| InChIKey | VTTGESYUYLSTAV-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 103.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 388.43 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 4-[[2-(2-ethylanilino)-1,3-benzoxazol-5-yl]oxymethyl]pyridine-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[[2-(2-ethylanilino)-1,3-benzoxazol-5-yl]oxymethyl]pyridine-2-carboxamide?
The IUPAC name of 4-[[2-(2-ethylanilino)-1,3-benzoxazol-5-yl]oxymethyl]pyridine-2-carboxamide (CID 91196797) is 4-[[2-(2-ethylanilino)-1,3-benzoxazol-5-yl]oxymethyl]pyridine-2-carboxamide.
What is the SMILES notation for 4-[[2-(2-ethylanilino)-1,3-benzoxazol-5-yl]oxymethyl]pyridine-2-carboxamide?
The canonical SMILES for 4-[[2-(2-ethylanilino)-1,3-benzoxazol-5-yl]oxymethyl]pyridine-2-carboxamide is CCc1ccccc1Nc1nc2cc(OCc3ccnc(C(N)=O)c3)ccc2o1.
What is the InChIKey of 4-[[2-(2-ethylanilino)-1,3-benzoxazol-5-yl]oxymethyl]pyridine-2-carboxamide?
The InChIKey is VTTGESYUYLSTAV-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H20N4O3/c1-2-15-5-3-4-6-17(15)25-22-26-18-12-16(7-8-20(18)29-22)28-13-14-9-10-24-19(11-14)21(23)27/h3-12H,2,13H2,1H3,(H2,23,27)(H,25,26).
What are the key properties of 4-[[2-(2-ethylanilino)-1,3-benzoxazol-5-yl]oxymethyl]pyridine-2-carboxamide?
4-[[2-(2-ethylanilino)-1,3-benzoxazol-5-yl]oxymethyl]pyridine-2-carboxamide has a molecular weight of 388.43 g/mol, XLogP of 4.21, 7 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[[2-(2-ethylanilino)-1,3-benzoxazol-5-yl]oxymethyl]pyridine-2-carboxamide is sourced from PubChem (CID 91196797), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).