About 2-[4-[1,2-dinitroso-2-[4-(2-phosphonoethyl)phenyl]ethyl]phenyl]ethylphosphonic acid
2-[4-[1,2-dinitroso-2-[4-(2-phosphonoethyl)phenyl]ethyl]phenyl]ethylphosphonic acid (PubChem CID 91196798) has the molecular formula C18H22N2O8P2
and a molecular weight of 456.33 g/mol. Its IUPAC name is 2-[4-[1,2-dinitroso-2-[4-(2-phosphonoethyl)phenyl]ethyl]phenyl]ethylphosphonic acid.
Molecular Properties
| Compound Name | 2-[4-[1,2-dinitroso-2-[4-(2-phosphonoethyl)phenyl]ethyl]phenyl]ethylphosphonic acid |
| PubChem CID | 91196798 |
| Molecular Formula | C18H22N2O8P2 |
| Molecular Weight | 456.33 g/mol |
| Exact Mass | 456.09 |
| IUPAC Name | 2-[4-[1,2-dinitroso-2-[4-(2-phosphonoethyl)phenyl]ethyl]phenyl]ethylphosphonic acid |
| SMILES | O=NC(c1ccc(CCP(=O)(O)O)cc1)C(N=O)c1ccc(CCP(=O)(O)O)cc1 |
| InChI | InChI=1S/C18H22N2O8P2/c21-19-17(15-5-1-13(2-6-15)9-11-29(23,24)25)18(20-22)16-7-3-14(4-8-16)10-12-30(26,27)28/h1-8,17-18H,9-12H2,(H2,23,24,25)(H2,26,27,28) |
| InChIKey | PWPHRUSUJRCJCM-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 173.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 456.33 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 2-[4-[1,2-dinitroso-2-[4-(2-phosphonoethyl)phenyl]ethyl]phenyl]ethylphosphonic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-[1,2-dinitroso-2-[4-(2-phosphonoethyl)phenyl]ethyl]phenyl]ethylphosphonic acid?
The IUPAC name of 2-[4-[1,2-dinitroso-2-[4-(2-phosphonoethyl)phenyl]ethyl]phenyl]ethylphosphonic acid (CID 91196798) is 2-[4-[1,2-dinitroso-2-[4-(2-phosphonoethyl)phenyl]ethyl]phenyl]ethylphosphonic acid.
What is the SMILES notation for 2-[4-[1,2-dinitroso-2-[4-(2-phosphonoethyl)phenyl]ethyl]phenyl]ethylphosphonic acid?
The canonical SMILES for 2-[4-[1,2-dinitroso-2-[4-(2-phosphonoethyl)phenyl]ethyl]phenyl]ethylphosphonic acid is O=NC(c1ccc(CCP(=O)(O)O)cc1)C(N=O)c1ccc(CCP(=O)(O)O)cc1.
What is the InChIKey of 2-[4-[1,2-dinitroso-2-[4-(2-phosphonoethyl)phenyl]ethyl]phenyl]ethylphosphonic acid?
The InChIKey is PWPHRUSUJRCJCM-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H22N2O8P2/c21-19-17(15-5-1-13(2-6-15)9-11-29(23,24)25)18(20-22)16-7-3-14(4-8-16)10-12-30(26,27)28/h1-8,17-18H,9-12H2,(H2,23,24,25)(H2,26,27,28).
What are the key properties of 2-[4-[1,2-dinitroso-2-[4-(2-phosphonoethyl)phenyl]ethyl]phenyl]ethylphosphonic acid?
2-[4-[1,2-dinitroso-2-[4-(2-phosphonoethyl)phenyl]ethyl]phenyl]ethylphosphonic acid has a molecular weight of 456.33 g/mol, XLogP of 3.44, 11 rotatable bonds, 4 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-[1,2-dinitroso-2-[4-(2-phosphonoethyl)phenyl]ethyl]phenyl]ethylphosphonic acid is sourced from PubChem (CID 91196798), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).