About 3-(2-hydroxyethylsulfanyl)propyl N-tert-butyl-N-[2-(2,3-dichlorophenyl)ethyl]carbamate
3-(2-hydroxyethylsulfanyl)propyl N-tert-butyl-N-[2-(2,3-dichlorophenyl)ethyl]carbamate (PubChem CID 91196851) has the molecular formula C18H27Cl2NO3S
and a molecular weight of 408.39 g/mol. Its IUPAC name is 3-(2-hydroxyethylsulfanyl)propyl N-tert-butyl-N-[2-(2,3-dichlorophenyl)ethyl]carbamate.
Molecular Properties
| Compound Name | 3-(2-hydroxyethylsulfanyl)propyl N-tert-butyl-N-[2-(2,3-dichlorophenyl)ethyl]carbamate |
| PubChem CID | 91196851 |
| Molecular Formula | C18H27Cl2NO3S |
| Molecular Weight | 408.39 g/mol |
| Exact Mass | 407.11 |
| IUPAC Name | 3-(2-hydroxyethylsulfanyl)propyl N-tert-butyl-N-[2-(2,3-dichlorophenyl)ethyl]carbamate |
| SMILES | CC(C)(C)N(CCc1cccc(Cl)c1Cl)C(=O)OCCCSCCO |
| InChI | InChI=1S/C18H27Cl2NO3S/c1-18(2,3)21(17(23)24-11-5-12-25-13-10-22)9-8-14-6-4-7-15(19)16(14)20/h4,6-7,22H,5,8-13H2,1-3H3 |
| InChIKey | RBYWTYBOPBMJLT-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 408.39 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-(2-hydroxyethylsulfanyl)propyl N-tert-butyl-N-[2-(2,3-dichlorophenyl)ethyl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2-hydroxyethylsulfanyl)propyl N-tert-butyl-N-[2-(2,3-dichlorophenyl)ethyl]carbamate?
The IUPAC name of 3-(2-hydroxyethylsulfanyl)propyl N-tert-butyl-N-[2-(2,3-dichlorophenyl)ethyl]carbamate (CID 91196851) is 3-(2-hydroxyethylsulfanyl)propyl N-tert-butyl-N-[2-(2,3-dichlorophenyl)ethyl]carbamate.
What is the SMILES notation for 3-(2-hydroxyethylsulfanyl)propyl N-tert-butyl-N-[2-(2,3-dichlorophenyl)ethyl]carbamate?
The canonical SMILES for 3-(2-hydroxyethylsulfanyl)propyl N-tert-butyl-N-[2-(2,3-dichlorophenyl)ethyl]carbamate is CC(C)(C)N(CCc1cccc(Cl)c1Cl)C(=O)OCCCSCCO.
What is the InChIKey of 3-(2-hydroxyethylsulfanyl)propyl N-tert-butyl-N-[2-(2,3-dichlorophenyl)ethyl]carbamate?
The InChIKey is RBYWTYBOPBMJLT-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H27Cl2NO3S/c1-18(2,3)21(17(23)24-11-5-12-25-13-10-22)9-8-14-6-4-7-15(19)16(14)20/h4,6-7,22H,5,8-13H2,1-3H3.
What are the key properties of 3-(2-hydroxyethylsulfanyl)propyl N-tert-butyl-N-[2-(2,3-dichlorophenyl)ethyl]carbamate?
3-(2-hydroxyethylsulfanyl)propyl N-tert-butyl-N-[2-(2,3-dichlorophenyl)ethyl]carbamate has a molecular weight of 408.39 g/mol, XLogP of 4.89, 9 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2-hydroxyethylsulfanyl)propyl N-tert-butyl-N-[2-(2,3-dichlorophenyl)ethyl]carbamate is sourced from PubChem (CID 91196851), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).