About CID 91197017
CID 91197017 (PubChem CID 91197017) has the molecular formula C4H7O2P
and a molecular weight of 118.07 g/mol.
Molecular Properties
| Compound Name | CID 91197017 |
| PubChem CID | 91197017 |
| Molecular Formula | C4H7O2P |
| Molecular Weight | 118.07 g/mol |
| Exact Mass | 118.02 |
| IUPAC Name | — |
| SMILES | C=CO/[P+]([O-])=C/C |
| InChI | InChI=1S/C4H7O2P/c1-3-6-7(5)4-2/h3-4H,1H2,2H3 |
| InChIKey | WVJPOSLEDZKQTK-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 32.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 118.07 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze CID 91197017 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 91197017?
The IUPAC name of CID 91197017 (CID 91197017) is not available.
What is the SMILES notation for CID 91197017?
The canonical SMILES for CID 91197017 is C=CO/[P+]([O-])=C/C.
What is the InChIKey of CID 91197017?
The InChIKey is WVJPOSLEDZKQTK-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H7O2P/c1-3-6-7(5)4-2/h3-4H,1H2,2H3.
What are the key properties of CID 91197017?
CID 91197017 has a molecular weight of 118.07 g/mol, XLogP of 0.64, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 91197017 is sourced from PubChem (CID 91197017), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).