C10H8F3NO6S — CID 91197426
(3,5-dihydroxy-9-oxa-4-azatetracyclo[5.3.1.02,6.08,10]undeca-2,5-dien-4-yl) trifluoromethanesulfonate (PubChem CID 91197426) has the molecular formula C10H8F3NO6S and a molecular weight of 327.24 g/mol. Its IUPAC name is (3,5-dihydroxy-9-oxa-4-azatetracyclo[5.3.1.02,6.08,10]undeca-2,5-dien-4-yl) trifluoromethanesulfonate.
| Compound Name | (3,5-dihydroxy-9-oxa-4-azatetracyclo[5.3.1.02,6.08,10]undeca-2,5-dien-4-yl) trifluoromethanesulfonate |
|---|---|
| PubChem CID | 91197426 |
| Molecular Formula | C10H8F3NO6S |
| Molecular Weight | 327.24 g/mol |
| Exact Mass | 327.00 |
| IUPAC Name | (3,5-dihydroxy-9-oxa-4-azatetracyclo[5.3.1.02,6.08,10]undeca-2,5-dien-4-yl) trifluoromethanesulfonate |
| SMILES | O=S(=O)(On1c(O)c2c(c1O)C1CC2C2OC12)C(F)(F)F |
| InChI | InChI=1S/C10H8F3NO6S/c11-10(12,13)21(17,18)20-14-8(15)4-2-1-3(5(4)9(14)16)7-6(2)19-7/h2-3,6-7,15-16H,1H2 |
| InChIKey | BIRMLTMZCZANDB-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 101.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.24 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|