C22H19F3N4O4S — CID 91197473
1-[[2-(2,6-dioxopiperidin-3-yl)-1-hydroxyisoindol-5-yl]methyl]-3-[4-(trifluoromethylsulfanyl)phenyl]urea (PubChem CID 91197473) has the molecular formula C22H19F3N4O4S and a molecular weight of 492.48 g/mol. Its IUPAC name is 1-[[2-(2,6-dioxopiperidin-3-yl)-1-hydroxyisoindol-5-yl]methyl]-3-[4-(trifluoromethylsulfanyl)phenyl]urea.
| Compound Name | 1-[[2-(2,6-dioxopiperidin-3-yl)-1-hydroxyisoindol-5-yl]methyl]-3-[4-(trifluoromethylsulfanyl)phenyl]urea |
|---|---|
| PubChem CID | 91197473 |
| Molecular Formula | C22H19F3N4O4S |
| Molecular Weight | 492.48 g/mol |
| Exact Mass | 492.11 |
| IUPAC Name | 1-[[2-(2,6-dioxopiperidin-3-yl)-1-hydroxyisoindol-5-yl]methyl]-3-[4-(trifluoromethylsulfanyl)phenyl]urea |
| SMILES | O=C1CCC(n2cc3cc(CNC(=O)Nc4ccc(SC(F)(F)F)cc4)ccc3c2O)C(=O)N1 |
| InChI | InChI=1S/C22H19F3N4O4S/c23-22(24,25)34-15-4-2-14(3-5-15)27-21(33)26-10-12-1-6-16-13(9-12)11-29(20(16)32)17-7-8-18(30)28-19(17)31/h1-6,9,11,17,32H,7-8,10H2,(H2,26,27,33)(H,28,30,31) |
| InChIKey | RHZUGXKYSFQDKB-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 112.46 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.48 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|