C18H29NO2 — CID 91197517
(2S)-2-(4,8-dimethyltrideca-3,7,11-trien-2-ylideneamino)propanoic acid (PubChem CID 91197517) has the molecular formula C18H29NO2 and a molecular weight of 291.44 g/mol. Its IUPAC name is (2S)-2-(4,8-dimethyltrideca-3,7,11-trien-2-ylideneamino)propanoic acid.
| Compound Name | (2S)-2-(4,8-dimethyltrideca-3,7,11-trien-2-ylideneamino)propanoic acid |
|---|---|
| PubChem CID | 91197517 |
| Molecular Formula | C18H29NO2 |
| Molecular Weight | 291.44 g/mol |
| Exact Mass | 291.22 |
| IUPAC Name | (2S)-2-(4,8-dimethyltrideca-3,7,11-trien-2-ylideneamino)propanoic acid |
| SMILES | CC=CCCC(C)=CCCC(C)=C/C(C)=N/[C@@H](C)C(=O)O |
| InChI | InChI=1S/C18H29NO2/c1-6-7-8-10-14(2)11-9-12-15(3)13-16(4)19-17(5)18(20)21/h6-7,11,13,17H,8-10,12H2,1-5H3,(H,20,21)/b7-6?,14-11?,15-13?,19-16+/t17-/m0/s1 |
| InChIKey | DUZROKOIWULFNL-ULIFTIBTSA-N |
| XLogP | 4.95 |
| TPSA | 49.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.44 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|