C11H10N2 — CID 91197563
5,9-diazatricyclo[7.4.0.02,4]trideca-1(13),2(4),5,7,11-pentaene (PubChem CID 91197563) has the molecular formula C11H10N2 and a molecular weight of 170.22 g/mol. Its IUPAC name is 5,9-diazatricyclo[7.4.0.02,4]trideca-1(13),2(4),5,7,11-pentaene.
| Compound Name | 5,9-diazatricyclo[7.4.0.02,4]trideca-1(13),2(4),5,7,11-pentaene |
|---|---|
| PubChem CID | 91197563 |
| Molecular Formula | C11H10N2 |
| Molecular Weight | 170.22 g/mol |
| Exact Mass | 170.08 |
| IUPAC Name | 5,9-diazatricyclo[7.4.0.02,4]trideca-1(13),2(4),5,7,11-pentaene |
| SMILES | C1=CCN2C=C/C=N\C3=C(C3)C2=C1 |
| InChI | InChI=1S/C11H10N2/c1-2-6-13-7-3-5-12-10-8-9(10)11(13)4-1/h1-5,7H,6,8H2/b7-3?,12-5- |
| InChIKey | LWPQZAYKFAFNNT-BTJGYZMISA-N |
| XLogP | 2.00 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.22 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |