C9H17NO6 — CID 91198097
N-[(4S,5R,6R)-4,5,6-trihydroxy-2-oxoheptan-3-yl]oxyacetamide (PubChem CID 91198097) has the molecular formula C9H17NO6 and a molecular weight of 235.24 g/mol. Its IUPAC name is N-[(4S,5R,6R)-4,5,6-trihydroxy-2-oxoheptan-3-yl]oxyacetamide.
| Compound Name | N-[(4S,5R,6R)-4,5,6-trihydroxy-2-oxoheptan-3-yl]oxyacetamide |
|---|---|
| PubChem CID | 91198097 |
| Molecular Formula | C9H17NO6 |
| Molecular Weight | 235.24 g/mol |
| Exact Mass | 235.11 |
| IUPAC Name | N-[(4S,5R,6R)-4,5,6-trihydroxy-2-oxoheptan-3-yl]oxyacetamide |
| SMILES | CC(=O)NOC(C(C)=O)[C@@H](O)[C@H](O)[C@@H](C)O |
| InChI | InChI=1S/C9H17NO6/c1-4(11)7(14)8(15)9(5(2)12)16-10-6(3)13/h4,7-9,11,14-15H,1-3H3,(H,10,13)/t4-,7-,8+,9?/m1/s1 |
| InChIKey | WNTJOCLONJJRFU-LPECYDOHSA-N |
| XLogP | -1.89 |
| TPSA | 116.09 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.24 |
| LogP ≤ 5 | -1.89 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|