C30H35FN2O4 — CID 91198494
6-cyclopentyl-6-[2-(3-fluoro-4-propan-2-yloxyphenyl)ethyl]-3-[(1-methylbenzimidazol-2-yl)methyl]oxane-2,4-dione (PubChem CID 91198494) has the molecular formula C30H35FN2O4 and a molecular weight of 506.62 g/mol. Its IUPAC name is 6-cyclopentyl-6-[2-(3-fluoro-4-propan-2-yloxyphenyl)ethyl]-3-[(1-methylbenzimidazol-2-yl)methyl]oxane-2,4-dione.
| Compound Name | 6-cyclopentyl-6-[2-(3-fluoro-4-propan-2-yloxyphenyl)ethyl]-3-[(1-methylbenzimidazol-2-yl)methyl]oxane-2,4-dione |
|---|---|
| PubChem CID | 91198494 |
| Molecular Formula | C30H35FN2O4 |
| Molecular Weight | 506.62 g/mol |
| Exact Mass | 506.26 |
| IUPAC Name | 6-cyclopentyl-6-[2-(3-fluoro-4-propan-2-yloxyphenyl)ethyl]-3-[(1-methylbenzimidazol-2-yl)methyl]oxane-2,4-dione |
| SMILES | CC(C)Oc1ccc(CCC2(C3CCCC3)CC(=O)C(Cc3nc4ccccc4n3C)C(=O)O2)cc1F |
| InChI | InChI=1S/C30H35FN2O4/c1-19(2)36-27-13-12-20(16-23(27)31)14-15-30(21-8-4-5-9-21)18-26(34)22(29(35)37-30)17-28-32-24-10-6-7-11-25(24)33(28)3/h6-7,10-13,16,19,21-22H,4-5,8-9,14-15,17-18H2,1-3H3 |
| InChIKey | UKVFAXQHWQSJLM-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 70.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.62 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|