C10H20N2 — CID 91198947
(2,2,6,6-tetramethylpiperidin-4-yl)methanimine (PubChem CID 91198947) has the molecular formula C10H20N2 and a molecular weight of 168.28 g/mol. Its IUPAC name is (2,2,6,6-tetramethylpiperidin-4-yl)methanimine.
| Compound Name | (2,2,6,6-tetramethylpiperidin-4-yl)methanimine |
|---|---|
| PubChem CID | 91198947 |
| Molecular Formula | C10H20N2 |
| Molecular Weight | 168.28 g/mol |
| Exact Mass | 168.16 |
| IUPAC Name | (2,2,6,6-tetramethylpiperidin-4-yl)methanimine |
| SMILES | [H]/N=C/C1CC(C)(C)NC(C)(C)C1 |
| InChI | InChI=1S/C10H20N2/c1-9(2)5-8(7-11)6-10(3,4)12-9/h7-8,11-12H,5-6H2,1-4H3/b11-7+ |
| InChIKey | OCTQLGBMXLYAJH-YRNVUSSQSA-N |
| XLogP | 2.19 |
| TPSA | 35.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.28 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|