C10H15F5O — CID 91198982
3-ethyl-4,4,5,5,5-pentafluoro-1-propoxypent-2-ene (PubChem CID 91198982) has the molecular formula C10H15F5O and a molecular weight of 246.22 g/mol. Its IUPAC name is 3-ethyl-4,4,5,5,5-pentafluoro-1-propoxypent-2-ene.
| Compound Name | 3-ethyl-4,4,5,5,5-pentafluoro-1-propoxypent-2-ene |
|---|---|
| PubChem CID | 91198982 |
| Molecular Formula | C10H15F5O |
| Molecular Weight | 246.22 g/mol |
| Exact Mass | 246.10 |
| IUPAC Name | 3-ethyl-4,4,5,5,5-pentafluoro-1-propoxypent-2-ene |
| SMILES | CCCOCC=C(CC)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C10H15F5O/c1-3-6-16-7-5-8(4-2)9(11,12)10(13,14)15/h5H,3-4,6-7H2,1-2H3 |
| InChIKey | XJJLCRVQXBNOEH-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.22 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|