C32H50O6 — CID 91199317
5-O-(ethoxymethyl) 4-O-ethyl 9,10-dimethyltetracyclo[6.2.1.13,6.02,7]dodecane-4,5-dicarboxylate;4-tricyclo[5.2.1.02,6]decanylmethanol (PubChem CID 91199317) has the molecular formula C32H50O6 and a molecular weight of 530.75 g/mol. Its IUPAC name is 5-O-(ethoxymethyl) 4-O-ethyl 9,10-dimethyltetracyclo[6.2.1.13,6.02,7]dodecane-4,5-dicarboxylate;4-tricyclo[5.2.1.02,6]decanylmethanol.
| Compound Name | 5-O-(ethoxymethyl) 4-O-ethyl 9,10-dimethyltetracyclo[6.2.1.13,6.02,7]dodecane-4,5-dicarboxylate;4-tricyclo[5.2.1.02,6]decanylmethanol |
|---|---|
| PubChem CID | 91199317 |
| Molecular Formula | C32H50O6 |
| Molecular Weight | 530.75 g/mol |
| Exact Mass | 530.36 |
| IUPAC Name | 5-O-(ethoxymethyl) 4-O-ethyl 9,10-dimethyltetracyclo[6.2.1.13,6.02,7]dodecane-4,5-dicarboxylate;4-tricyclo[5.2.1.02,6]decanylmethanol |
| SMILES | CCOCOC(=O)C1C2CC(C1C(=O)OCC)C1C3CC(C(C)C3C)C21.OCC1CC2C3CCC(C3)C2C1 |
| InChI | InChI=1S/C21H32O5.C11H18O/c1-5-24-9-26-21(23)19-15-8-14(18(19)20(22)25-6-2)16-12-7-13(17(15)16)11(4)10(12)3;12-6-7-3-10-8-1-2-9(5-8)11(10)4-7/h10-19H,5-9H2,1-4H3;7-12H,1-6H2 |
| InChIKey | WGVZQXKOYHHAEA-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.75 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cyclooctane_1', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|