C30H26FN3O2 — CID 91199318
4-[4-[[4-fluoro-2-(6-piperidin-1-yl-2-pyridinyl)phenoxy]methyl]phenoxy]benzonitrile (PubChem CID 91199318) has the molecular formula C30H26FN3O2 and a molecular weight of 479.56 g/mol. Its IUPAC name is 4-[4-[[4-fluoro-2-(6-piperidin-1-yl-2-pyridinyl)phenoxy]methyl]phenoxy]benzonitrile.
| Compound Name | 4-[4-[[4-fluoro-2-(6-piperidin-1-yl-2-pyridinyl)phenoxy]methyl]phenoxy]benzonitrile |
|---|---|
| PubChem CID | 91199318 |
| Molecular Formula | C30H26FN3O2 |
| Molecular Weight | 479.56 g/mol |
| Exact Mass | 479.20 |
| IUPAC Name | 4-[4-[[4-fluoro-2-(6-piperidin-1-yl-2-pyridinyl)phenoxy]methyl]phenoxy]benzonitrile |
| SMILES | N#Cc1ccc(Oc2ccc(COc3ccc(F)cc3-c3cccc(N4CCCCC4)n3)cc2)cc1 |
| InChI | InChI=1S/C30H26FN3O2/c31-24-11-16-29(27(19-24)28-5-4-6-30(33-28)34-17-2-1-3-18-34)35-21-23-9-14-26(15-10-23)36-25-12-7-22(20-32)8-13-25/h4-16,19H,1-3,17-18,21H2 |
| InChIKey | MRQUTUKFGAGPHE-UHFFFAOYSA-N |
| XLogP | 7.12 |
| TPSA | 58.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.56 |
| LogP ≤ 5 | 7.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |