C28H33NO2S — CID 91199516
4-hydroxy-3-[[4-[1-(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)cyclopropyl]phenyl]methyl]-1,3-thiazol-2-one (PubChem CID 91199516) has the molecular formula C28H33NO2S and a molecular weight of 447.64 g/mol. Its IUPAC name is 4-hydroxy-3-[[4-[1-(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)cyclopropyl]phenyl]methyl]-1,3-thiazol-2-one.
| Compound Name | 4-hydroxy-3-[[4-[1-(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)cyclopropyl]phenyl]methyl]-1,3-thiazol-2-one |
|---|---|
| PubChem CID | 91199516 |
| Molecular Formula | C28H33NO2S |
| Molecular Weight | 447.64 g/mol |
| Exact Mass | 447.22 |
| IUPAC Name | 4-hydroxy-3-[[4-[1-(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)cyclopropyl]phenyl]methyl]-1,3-thiazol-2-one |
| SMILES | Cc1cc2c(cc1C1(c3ccc(Cn4c(O)csc4=O)cc3)CC1)C(C)(C)CCC2(C)C |
| InChI | InChI=1S/C28H33NO2S/c1-18-14-22-23(27(4,5)11-10-26(22,2)3)15-21(18)28(12-13-28)20-8-6-19(7-9-20)16-29-24(30)17-32-25(29)31/h6-9,14-15,17,30H,10-13,16H2,1-5H3 |
| InChIKey | ITGYJDYFSKACRY-UHFFFAOYSA-N |
| XLogP | 6.40 |
| TPSA | 42.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.64 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |