C11H16N2 — CID 91199527
2,3,3a,5,6,7,8,9a-octahydro-1H-cyclopenta[b]quinoxaline (PubChem CID 91199527) has the molecular formula C11H16N2 and a molecular weight of 176.26 g/mol. Its IUPAC name is 2,3,3a,5,6,7,8,9a-octahydro-1H-cyclopenta[b]quinoxaline.
| Compound Name | 2,3,3a,5,6,7,8,9a-octahydro-1H-cyclopenta[b]quinoxaline |
|---|---|
| PubChem CID | 91199527 |
| Molecular Formula | C11H16N2 |
| Molecular Weight | 176.26 g/mol |
| Exact Mass | 176.13 |
| IUPAC Name | 2,3,3a,5,6,7,8,9a-octahydro-1H-cyclopenta[b]quinoxaline |
| SMILES | C1CCC2=NC3CCCC3N=C2C1 |
| InChI | InChI=1S/C11H16N2/c1-2-5-9-8(4-1)12-10-6-3-7-11(10)13-9/h10-11H,1-7H2 |
| InChIKey | IZIWKKCBACVUTA-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.26 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |