C28H35FN4O8 — CID 91200196
4-(dimethylamino)-7-fluoro-10,12a-dihydroxy-1,3,11,12-tetraoxo-9-[[2-(pentylamino)acetyl]amino]-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide (PubChem CID 91200196) has the molecular formula C28H35FN4O8 and a molecular weight of 574.61 g/mol. Its IUPAC name is 4-(dimethylamino)-7-fluoro-10,12a-dihydroxy-1,3,11,12-tetraoxo-9-[[2-(pentylamino)acetyl]amino]-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide.
| Compound Name | 4-(dimethylamino)-7-fluoro-10,12a-dihydroxy-1,3,11,12-tetraoxo-9-[[2-(pentylamino)acetyl]amino]-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide |
|---|---|
| PubChem CID | 91200196 |
| Molecular Formula | C28H35FN4O8 |
| Molecular Weight | 574.61 g/mol |
| Exact Mass | 574.24 |
| IUPAC Name | 4-(dimethylamino)-7-fluoro-10,12a-dihydroxy-1,3,11,12-tetraoxo-9-[[2-(pentylamino)acetyl]amino]-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide |
| SMILES | CCCCCNCC(=O)Nc1cc(F)c2c(c1O)C(=O)C1C(=O)C3(O)C(=O)C(C(N)=O)C(=O)C(N(C)C)C3CC1C2 |
| InChI | InChI=1S/C28H35FN4O8/c1-4-5-6-7-31-11-17(34)32-16-10-15(29)13-8-12-9-14-21(33(2)3)24(37)20(27(30)40)26(39)28(14,41)25(38)18(12)23(36)19(13)22(16)35/h10,12,14,18,20-21,31,35,41H,4-9,11H2,1-3H3,(H2,30,40)(H,32,34) |
| InChIKey | MDHWXMHWRCAGCW-UHFFFAOYSA-N |
| XLogP | -0.28 |
| TPSA | 196.20 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.61 |
| LogP ≤ 5 | -0.28 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|