C14H30N+ — CID 91200410
2-(3,3-dimethylheptan-4-yl)-1,1,2-trimethylaziridin-1-ium (PubChem CID 91200410) has the molecular formula C14H30N+ and a molecular weight of 212.40 g/mol. Its IUPAC name is 2-(3,3-dimethylheptan-4-yl)-1,1,2-trimethylaziridin-1-ium.
| Compound Name | 2-(3,3-dimethylheptan-4-yl)-1,1,2-trimethylaziridin-1-ium |
|---|---|
| PubChem CID | 91200410 |
| Molecular Formula | C14H30N+ |
| Molecular Weight | 212.40 g/mol |
| Exact Mass | 212.24 |
| IUPAC Name | 2-(3,3-dimethylheptan-4-yl)-1,1,2-trimethylaziridin-1-ium |
| SMILES | CCCC(C(C)(C)CC)C1(C)C[N+]1(C)C |
| InChI | InChI=1S/C14H30N/c1-8-10-12(13(3,4)9-2)14(5)11-15(14,6)7/h12H,8-11H2,1-7H3/q+1 |
| InChIKey | JYENEOXZELEVCH-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.40 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|