C36H41F2N9O2 — CID 91200464
1-[2-[6-[2,4-difluoro-3-[2-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)ethylcarbamoylamino]phenyl]-5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl]ethyl]-3-[4-(dimethylamino)phenyl]urea (PubChem CID 91200464) has the molecular formula C36H41F2N9O2 and a molecular weight of 669.78 g/mol. Its IUPAC name is 1-[2-[6-[2,4-difluoro-3-[2-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)ethylcarbamoylamino]phenyl]-5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl]ethyl]-3-[4-(dimethylamino)phenyl]urea.
| Compound Name | 1-[2-[6-[2,4-difluoro-3-[2-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)ethylcarbamoylamino]phenyl]-5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl]ethyl]-3-[4-(dimethylamino)phenyl]urea |
|---|---|
| PubChem CID | 91200464 |
| Molecular Formula | C36H41F2N9O2 |
| Molecular Weight | 669.78 g/mol |
| Exact Mass | 669.34 |
| IUPAC Name | 1-[2-[6-[2,4-difluoro-3-[2-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)ethylcarbamoylamino]phenyl]-5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl]ethyl]-3-[4-(dimethylamino)phenyl]urea |
| SMILES | CN(C)c1ccc(NC(=O)NCCc2ccc3c(n2)NCC(c2ccc(F)c(NC(=O)NCCc4ccc5c(n4)NCCC5)c2F)C3)cc1 |
| InChI | InChI=1S/C36H41F2N9O2/c1-47(2)28-11-9-25(10-12-28)45-35(48)40-18-15-27-8-6-23-20-24(21-42-34(23)44-27)29-13-14-30(37)32(31(29)38)46-36(49)41-19-16-26-7-5-22-4-3-17-39-33(22)43-26/h5-14,24H,3-4,15-21H2,1-2H3,(H,39,43)(H,42,44)(H2,40,45,48)(H2,41,46,49) |
| InChIKey | UBVCGAMGGGSQCV-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 135.34 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 49 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 669.78 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|