About 4-methylpent-1-ene
4-methylpent-1-ene (PubChem CID 91200523) has the molecular formula C6H11-
and a molecular weight of 83.15 g/mol. Its IUPAC name is 4-methylpent-1-ene.
Molecular Properties
| Compound Name | 4-methylpent-1-ene |
| PubChem CID | 91200523 |
| Molecular Formula | C6H11- |
| Molecular Weight | 83.15 g/mol |
| Exact Mass | 83.09 |
| IUPAC Name | 4-methylpent-1-ene |
| SMILES | C=[C-]CC(C)C |
| InChI | InChI=1S/C6H11/c1-4-5-6(2)3/h6H,1,5H2,2-3H3/q-1 |
| InChIKey | QNZIBOXHHZZZCD-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 83.15 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 4-methylpent-1-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methylpent-1-ene?
The IUPAC name of 4-methylpent-1-ene (CID 91200523) is 4-methylpent-1-ene.
What is the SMILES notation for 4-methylpent-1-ene?
The canonical SMILES for 4-methylpent-1-ene is C=[C-]CC(C)C.
What is the InChIKey of 4-methylpent-1-ene?
The InChIKey is QNZIBOXHHZZZCD-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H11/c1-4-5-6(2)3/h6H,1,5H2,2-3H3/q-1.
What are the key properties of 4-methylpent-1-ene?
4-methylpent-1-ene has a molecular weight of 83.15 g/mol, XLogP of 2.02, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methylpent-1-ene is sourced from PubChem (CID 91200523), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).