About CID 91200950
CID 91200950 (PubChem CID 91200950) has the molecular formula C10H14B
and a molecular weight of 145.03 g/mol.
Molecular Properties
| Compound Name | CID 91200950 |
| PubChem CID | 91200950 |
| Molecular Formula | C10H14B |
| Molecular Weight | 145.03 g/mol |
| Exact Mass | 145.12 |
| IUPAC Name | — |
| SMILES | C#CC(C)C[B]CC(C)C#C |
| InChI | InChI=1S/C10H14B/c1-5-9(3)7-11-8-10(4)6-2/h1-2,9-10H,7-8H2,3-4H3 |
| InChIKey | XSISDCMUWUGUCS-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 145.03 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze CID 91200950 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 91200950?
The IUPAC name of CID 91200950 (CID 91200950) is not available.
What is the SMILES notation for CID 91200950?
The canonical SMILES for CID 91200950 is C#CC(C)C[B]CC(C)C#C.
What is the InChIKey of CID 91200950?
The InChIKey is XSISDCMUWUGUCS-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14B/c1-5-9(3)7-11-8-10(4)6-2/h1-2,9-10H,7-8H2,3-4H3.
What are the key properties of CID 91200950?
CID 91200950 has a molecular weight of 145.03 g/mol, XLogP of 2.07, 4 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for CID 91200950 is sourced from PubChem (CID 91200950), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).