C39H50 — CID 91200987
(4aS,9S,9aR)-2,7-ditert-butyl-9-[cyclopentyl(diphenyl)methyl]-2,3,4,4a,9,9a-hexahydro-1H-fluorene (PubChem CID 91200987) has the molecular formula C39H50 and a molecular weight of 518.83 g/mol. Its IUPAC name is (4aS,9S,9aR)-2,7-ditert-butyl-9-[cyclopentyl(diphenyl)methyl]-2,3,4,4a,9,9a-hexahydro-1H-fluorene.
| Compound Name | (4aS,9S,9aR)-2,7-ditert-butyl-9-[cyclopentyl(diphenyl)methyl]-2,3,4,4a,9,9a-hexahydro-1H-fluorene |
|---|---|
| PubChem CID | 91200987 |
| Molecular Formula | C39H50 |
| Molecular Weight | 518.83 g/mol |
| Exact Mass | 518.39 |
| IUPAC Name | (4aS,9S,9aR)-2,7-ditert-butyl-9-[cyclopentyl(diphenyl)methyl]-2,3,4,4a,9,9a-hexahydro-1H-fluorene |
| SMILES | CC(C)(C)c1ccc2c(c1)[C@@H](C(c1ccccc1)(c1ccccc1)C1CCCC1)[C@@H]1CC(C(C)(C)C)CC[C@H]21 |
| InChI | InChI=1S/C39H50/c1-37(2,3)30-21-23-32-33-24-22-31(38(4,5)6)26-35(33)36(34(32)25-30)39(29-19-13-14-20-29,27-15-9-7-10-16-27)28-17-11-8-12-18-28/h7-12,15-18,21,23,25,29,31,33,35-36H,13-14,19-20,22,24,26H2,1-6H3/t31?,33-,35-,36-/m1/s1 |
| InChIKey | AULPNZRALXUWPW-OYRFZSQNSA-N |
| XLogP | 10.80 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.83 |
| LogP ≤ 5 | 10.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |