About 6-(4-methoxycyclohexa-2,4-dien-1-yl)-N-propan-2-ylhept-5-en-2-imine
6-(4-methoxycyclohexa-2,4-dien-1-yl)-N-propan-2-ylhept-5-en-2-imine (PubChem CID 91201251) has the molecular formula C17H27NO
and a molecular weight of 261.41 g/mol. Its IUPAC name is 6-(4-methoxycyclohexa-2,4-dien-1-yl)-N-propan-2-ylhept-5-en-2-imine.
Molecular Properties
| Compound Name | 6-(4-methoxycyclohexa-2,4-dien-1-yl)-N-propan-2-ylhept-5-en-2-imine |
| PubChem CID | 91201251 |
| Molecular Formula | C17H27NO |
| Molecular Weight | 261.41 g/mol |
| Exact Mass | 261.21 |
| IUPAC Name | 6-(4-methoxycyclohexa-2,4-dien-1-yl)-N-propan-2-ylhept-5-en-2-imine |
| SMILES | COC1=CCC(C(C)=CCC/C(C)=N/C(C)C)C=C1 |
| InChI | InChI=1S/C17H27NO/c1-13(2)18-15(4)8-6-7-14(3)16-9-11-17(19-5)12-10-16/h7,9,11-13,16H,6,8,10H2,1-5H3/b14-7?,18-15+ |
| InChIKey | AJDIIYOXNRYAMJ-WQXBMBEASA-N |
| XLogP | 4.69 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 261.41 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 6-(4-methoxycyclohexa-2,4-dien-1-yl)-N-propan-2-ylhept-5-en-2-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(4-methoxycyclohexa-2,4-dien-1-yl)-N-propan-2-ylhept-5-en-2-imine?
The IUPAC name of 6-(4-methoxycyclohexa-2,4-dien-1-yl)-N-propan-2-ylhept-5-en-2-imine (CID 91201251) is 6-(4-methoxycyclohexa-2,4-dien-1-yl)-N-propan-2-ylhept-5-en-2-imine.
What is the SMILES notation for 6-(4-methoxycyclohexa-2,4-dien-1-yl)-N-propan-2-ylhept-5-en-2-imine?
The canonical SMILES for 6-(4-methoxycyclohexa-2,4-dien-1-yl)-N-propan-2-ylhept-5-en-2-imine is COC1=CCC(C(C)=CCC/C(C)=N/C(C)C)C=C1.
What is the InChIKey of 6-(4-methoxycyclohexa-2,4-dien-1-yl)-N-propan-2-ylhept-5-en-2-imine?
The InChIKey is AJDIIYOXNRYAMJ-WQXBMBEASA-N. The full InChI is InChI=1S/C17H27NO/c1-13(2)18-15(4)8-6-7-14(3)16-9-11-17(19-5)12-10-16/h7,9,11-13,16H,6,8,10H2,1-5H3/b14-7?,18-15+.
What are the key properties of 6-(4-methoxycyclohexa-2,4-dien-1-yl)-N-propan-2-ylhept-5-en-2-imine?
6-(4-methoxycyclohexa-2,4-dien-1-yl)-N-propan-2-ylhept-5-en-2-imine has a molecular weight of 261.41 g/mol, XLogP of 4.69, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(4-methoxycyclohexa-2,4-dien-1-yl)-N-propan-2-ylhept-5-en-2-imine is sourced from PubChem (CID 91201251), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).