About 1-ethynylpentalene
1-ethynylpentalene (PubChem CID 91201950) has the molecular formula C10H6
and a molecular weight of 126.16 g/mol. Its IUPAC name is 1-ethynylpentalene.
Molecular Properties
| Compound Name | 1-ethynylpentalene |
| PubChem CID | 91201950 |
| Molecular Formula | C10H6 |
| Molecular Weight | 126.16 g/mol |
| Exact Mass | 126.05 |
| IUPAC Name | 1-ethynylpentalene |
| SMILES | C#CC1=CC=C2C=CC=C12 |
| InChI | InChI=1S/C10H6/c1-2-8-6-7-9-4-3-5-10(8)9/h1,3-7H |
| InChIKey | DEVVCQHBCLFKAC-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 126.16 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-ethynylpentalene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethynylpentalene?
The IUPAC name of 1-ethynylpentalene (CID 91201950) is 1-ethynylpentalene.
What is the SMILES notation for 1-ethynylpentalene?
The canonical SMILES for 1-ethynylpentalene is C#CC1=CC=C2C=CC=C12.
What is the InChIKey of 1-ethynylpentalene?
The InChIKey is DEVVCQHBCLFKAC-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H6/c1-2-8-6-7-9-4-3-5-10(8)9/h1,3-7H.
What are the key properties of 1-ethynylpentalene?
1-ethynylpentalene has a molecular weight of 126.16 g/mol, XLogP of 1.98, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethynylpentalene is sourced from PubChem (CID 91201950), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).