C7H8F9NO2S — CID 91202132
1,1,1,2,2,3,3,4,4-nonafluoro-6-[methyl(sulfino)amino]hexane (PubChem CID 91202132) has the molecular formula C7H8F9NO2S and a molecular weight of 341.20 g/mol. Its IUPAC name is 1,1,1,2,2,3,3,4,4-nonafluoro-6-[methyl(sulfino)amino]hexane.
| Compound Name | 1,1,1,2,2,3,3,4,4-nonafluoro-6-[methyl(sulfino)amino]hexane |
|---|---|
| PubChem CID | 91202132 |
| Molecular Formula | C7H8F9NO2S |
| Molecular Weight | 341.20 g/mol |
| Exact Mass | 341.01 |
| IUPAC Name | 1,1,1,2,2,3,3,4,4-nonafluoro-6-[methyl(sulfino)amino]hexane |
| SMILES | CN(CCC(F)(F)C(F)(F)C(F)(F)C(F)(F)F)S(=O)O |
| InChI | InChI=1S/C7H8F9NO2S/c1-17(20(18)19)3-2-4(8,9)5(10,11)6(12,13)7(14,15)16/h2-3H2,1H3,(H,18,19) |
| InChIKey | WZSTUYXGFJVWSP-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.20 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|