C11H17F3N2O3 — CID 91202602
(3S)-3-[(E,2S)-2-aminopent-3-enyl]pyrrolidin-2-one;2,2,2-trifluoroacetic acid (PubChem CID 91202602) has the molecular formula C11H17F3N2O3 and a molecular weight of 282.26 g/mol. Its IUPAC name is (3S)-3-[(E,2S)-2-aminopent-3-enyl]pyrrolidin-2-one;2,2,2-trifluoroacetic acid.
| Compound Name | (3S)-3-[(E,2S)-2-aminopent-3-enyl]pyrrolidin-2-one;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 91202602 |
| Molecular Formula | C11H17F3N2O3 |
| Molecular Weight | 282.26 g/mol |
| Exact Mass | 282.12 |
| IUPAC Name | (3S)-3-[(E,2S)-2-aminopent-3-enyl]pyrrolidin-2-one;2,2,2-trifluoroacetic acid |
| SMILES | C/C=C/[C@@H](N)C[C@@H]1CCNC1=O.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C9H16N2O.C2HF3O2/c1-2-3-8(10)6-7-4-5-11-9(7)12;3-2(4,5)1(6)7/h2-3,7-8H,4-6,10H2,1H3,(H,11,12);(H,6,7)/b3-2+;/t7-,8+;/m0./s1 |
| InChIKey | HNSOGIZUNZYRBZ-FAIMFHAESA-N |
| XLogP | 1.05 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.26 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|