About methyl 3-[(3,5-dimethylpyrazin-2-yl)amino]propanoate
methyl 3-[(3,5-dimethylpyrazin-2-yl)amino]propanoate (PubChem CID 91202639) has the molecular formula C10H15N3O2
and a molecular weight of 209.25 g/mol. Its IUPAC name is methyl 3-[(3,5-dimethylpyrazin-2-yl)amino]propanoate.
Molecular Properties
| Compound Name | methyl 3-[(3,5-dimethylpyrazin-2-yl)amino]propanoate |
| PubChem CID | 91202639 |
| Molecular Formula | C10H15N3O2 |
| Molecular Weight | 209.25 g/mol |
| Exact Mass | 209.12 |
| IUPAC Name | methyl 3-[(3,5-dimethylpyrazin-2-yl)amino]propanoate |
| SMILES | COC(=O)CCNc1ncc(C)nc1C |
| InChI | InChI=1S/C10H15N3O2/c1-7-6-12-10(8(2)13-7)11-5-4-9(14)15-3/h6H,4-5H2,1-3H3,(H,11,12) |
| InChIKey | SRQYUCLJPMWKMC-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.25 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze methyl 3-[(3,5-dimethylpyrazin-2-yl)amino]propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 3-[(3,5-dimethylpyrazin-2-yl)amino]propanoate?
The IUPAC name of methyl 3-[(3,5-dimethylpyrazin-2-yl)amino]propanoate (CID 91202639) is methyl 3-[(3,5-dimethylpyrazin-2-yl)amino]propanoate.
What is the SMILES notation for methyl 3-[(3,5-dimethylpyrazin-2-yl)amino]propanoate?
The canonical SMILES for methyl 3-[(3,5-dimethylpyrazin-2-yl)amino]propanoate is COC(=O)CCNc1ncc(C)nc1C.
What is the InChIKey of methyl 3-[(3,5-dimethylpyrazin-2-yl)amino]propanoate?
The InChIKey is SRQYUCLJPMWKMC-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15N3O2/c1-7-6-12-10(8(2)13-7)11-5-4-9(14)15-3/h6H,4-5H2,1-3H3,(H,11,12).
What are the key properties of methyl 3-[(3,5-dimethylpyrazin-2-yl)amino]propanoate?
methyl 3-[(3,5-dimethylpyrazin-2-yl)amino]propanoate has a molecular weight of 209.25 g/mol, XLogP of 1.07, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-[(3,5-dimethylpyrazin-2-yl)amino]propanoate is sourced from PubChem (CID 91202639), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).