About (5-hydroxy-2-oxo-1,3-dihydroimidazol-4-yl)methanesulfonamide
(5-hydroxy-2-oxo-1,3-dihydroimidazol-4-yl)methanesulfonamide (PubChem CID 91202879) has the molecular formula C4H7N3O4S
and a molecular weight of 193.18 g/mol. Its IUPAC name is (5-hydroxy-2-oxo-1,3-dihydroimidazol-4-yl)methanesulfonamide.
Molecular Properties
| Compound Name | (5-hydroxy-2-oxo-1,3-dihydroimidazol-4-yl)methanesulfonamide |
| PubChem CID | 91202879 |
| Molecular Formula | C4H7N3O4S |
| Molecular Weight | 193.18 g/mol |
| Exact Mass | 193.02 |
| IUPAC Name | (5-hydroxy-2-oxo-1,3-dihydroimidazol-4-yl)methanesulfonamide |
| SMILES | NS(=O)(=O)Cc1[nH]c(=O)[nH]c1O |
| InChI | InChI=1S/C4H7N3O4S/c5-12(10,11)1-2-3(8)7-4(9)6-2/h8H,1H2,(H2,5,10,11)(H2,6,7,9) |
| InChIKey | RJYUEEVTPHLQMV-UHFFFAOYSA-N |
| XLogP | -1.80 |
| TPSA | 129.04 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 193.18 |
| LogP ≤ 5 | -1.80 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (5-hydroxy-2-oxo-1,3-dihydroimidazol-4-yl)methanesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5-hydroxy-2-oxo-1,3-dihydroimidazol-4-yl)methanesulfonamide?
The IUPAC name of (5-hydroxy-2-oxo-1,3-dihydroimidazol-4-yl)methanesulfonamide (CID 91202879) is (5-hydroxy-2-oxo-1,3-dihydroimidazol-4-yl)methanesulfonamide.
What is the SMILES notation for (5-hydroxy-2-oxo-1,3-dihydroimidazol-4-yl)methanesulfonamide?
The canonical SMILES for (5-hydroxy-2-oxo-1,3-dihydroimidazol-4-yl)methanesulfonamide is NS(=O)(=O)Cc1[nH]c(=O)[nH]c1O.
What is the InChIKey of (5-hydroxy-2-oxo-1,3-dihydroimidazol-4-yl)methanesulfonamide?
The InChIKey is RJYUEEVTPHLQMV-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H7N3O4S/c5-12(10,11)1-2-3(8)7-4(9)6-2/h8H,1H2,(H2,5,10,11)(H2,6,7,9).
What are the key properties of (5-hydroxy-2-oxo-1,3-dihydroimidazol-4-yl)methanesulfonamide?
(5-hydroxy-2-oxo-1,3-dihydroimidazol-4-yl)methanesulfonamide has a molecular weight of 193.18 g/mol, XLogP of -1.80, 2 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (5-hydroxy-2-oxo-1,3-dihydroimidazol-4-yl)methanesulfonamide is sourced from PubChem (CID 91202879), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).