C9H16N4 — CID 91203027
1-N'-(3-amino-2-methylphenyl)ethane-1,1,2-triamine (PubChem CID 91203027) has the molecular formula C9H16N4 and a molecular weight of 180.25 g/mol. Its IUPAC name is 1-N'-(3-amino-2-methylphenyl)ethane-1,1,2-triamine.
| Compound Name | 1-N'-(3-amino-2-methylphenyl)ethane-1,1,2-triamine |
|---|---|
| PubChem CID | 91203027 |
| Molecular Formula | C9H16N4 |
| Molecular Weight | 180.25 g/mol |
| Exact Mass | 180.14 |
| IUPAC Name | 1-N'-(3-amino-2-methylphenyl)ethane-1,1,2-triamine |
| SMILES | Cc1c(N)cccc1NC(N)CN |
| InChI | InChI=1S/C9H16N4/c1-6-7(11)3-2-4-8(6)13-9(12)5-10/h2-4,9,13H,5,10-12H2,1H3 |
| InChIKey | ZEFMYWIZNNAUJD-UHFFFAOYSA-N |
| XLogP | 0.23 |
| TPSA | 90.09 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.25 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|