About (2S)-2-chloro-4-(difluoromethyl)-2,5-dihydropyridine
(2S)-2-chloro-4-(difluoromethyl)-2,5-dihydropyridine (PubChem CID 91203093) has the molecular formula C6H6ClF2N
and a molecular weight of 165.57 g/mol. Its IUPAC name is (2S)-2-chloro-4-(difluoromethyl)-2,5-dihydropyridine.
Molecular Properties
| Compound Name | (2S)-2-chloro-4-(difluoromethyl)-2,5-dihydropyridine |
| PubChem CID | 91203093 |
| Molecular Formula | C6H6ClF2N |
| Molecular Weight | 165.57 g/mol |
| Exact Mass | 165.02 |
| IUPAC Name | (2S)-2-chloro-4-(difluoromethyl)-2,5-dihydropyridine |
| SMILES | FC(F)C1=C[C@H](Cl)N=CC1 |
| InChI | InChI=1S/C6H6ClF2N/c7-5-3-4(6(8)9)1-2-10-5/h2-3,5-6H,1H2/t5-/m1/s1 |
| InChIKey | QIFUVTJQYBGLML-RXMQYKEDSA-N |
| XLogP | 2.22 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 165.57 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|
Analyze (2S)-2-chloro-4-(difluoromethyl)-2,5-dihydropyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-2-chloro-4-(difluoromethyl)-2,5-dihydropyridine?
The IUPAC name of (2S)-2-chloro-4-(difluoromethyl)-2,5-dihydropyridine (CID 91203093) is (2S)-2-chloro-4-(difluoromethyl)-2,5-dihydropyridine.
What is the SMILES notation for (2S)-2-chloro-4-(difluoromethyl)-2,5-dihydropyridine?
The canonical SMILES for (2S)-2-chloro-4-(difluoromethyl)-2,5-dihydropyridine is FC(F)C1=C[C@H](Cl)N=CC1.
What is the InChIKey of (2S)-2-chloro-4-(difluoromethyl)-2,5-dihydropyridine?
The InChIKey is QIFUVTJQYBGLML-RXMQYKEDSA-N. The full InChI is InChI=1S/C6H6ClF2N/c7-5-3-4(6(8)9)1-2-10-5/h2-3,5-6H,1H2/t5-/m1/s1.
What are the key properties of (2S)-2-chloro-4-(difluoromethyl)-2,5-dihydropyridine?
(2S)-2-chloro-4-(difluoromethyl)-2,5-dihydropyridine has a molecular weight of 165.57 g/mol, XLogP of 2.22, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2-chloro-4-(difluoromethyl)-2,5-dihydropyridine is sourced from PubChem (CID 91203093), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).