C23H18Cl2N2O — CID 91203133
4-(2,4-dichlorophenyl)-3-isocyano-2-methyl-7-phenyl-4,6,7,8-tetrahydro-3H-quinolin-5-one (PubChem CID 91203133) has the molecular formula C23H18Cl2N2O and a molecular weight of 409.32 g/mol. Its IUPAC name is 4-(2,4-dichlorophenyl)-3-isocyano-2-methyl-7-phenyl-4,6,7,8-tetrahydro-3H-quinolin-5-one.
| Compound Name | 4-(2,4-dichlorophenyl)-3-isocyano-2-methyl-7-phenyl-4,6,7,8-tetrahydro-3H-quinolin-5-one |
|---|---|
| PubChem CID | 91203133 |
| Molecular Formula | C23H18Cl2N2O |
| Molecular Weight | 409.32 g/mol |
| Exact Mass | 408.08 |
| IUPAC Name | 4-(2,4-dichlorophenyl)-3-isocyano-2-methyl-7-phenyl-4,6,7,8-tetrahydro-3H-quinolin-5-one |
| SMILES | [C-]#[N+]C1C(C)=NC2=C(C(=O)CC(c3ccccc3)C2)C1c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C23H18Cl2N2O/c1-13-23(26-2)21(17-9-8-16(24)12-18(17)25)22-19(27-13)10-15(11-20(22)28)14-6-4-3-5-7-14/h3-9,12,15,21,23H,10-11H2,1H3 |
| InChIKey | PYBSREOXWVLWIC-UHFFFAOYSA-N |
| XLogP | 6.24 |
| TPSA | 33.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.32 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|