About (2-amino-1,3-thiazol-5-yl)-phenylmethanone;ethane
(2-amino-1,3-thiazol-5-yl)-phenylmethanone;ethane (PubChem CID 91203286) has the molecular formula C12H14N2OS
and a molecular weight of 234.32 g/mol. Its IUPAC name is (2-amino-1,3-thiazol-5-yl)-phenylmethanone;ethane.
Molecular Properties
| Compound Name | (2-amino-1,3-thiazol-5-yl)-phenylmethanone;ethane |
| PubChem CID | 91203286 |
| Molecular Formula | C12H14N2OS |
| Molecular Weight | 234.32 g/mol |
| Exact Mass | 234.08 |
| IUPAC Name | (2-amino-1,3-thiazol-5-yl)-phenylmethanone;ethane |
| SMILES | CC.Nc1ncc(C(=O)c2ccccc2)s1 |
| InChI | InChI=1S/C10H8N2OS.C2H6/c11-10-12-6-8(14-10)9(13)7-4-2-1-3-5-7;1-2/h1-6H,(H2,11,12);1-2H3 |
| InChIKey | LLYUITJRHZDEIW-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 55.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.32 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (2-amino-1,3-thiazol-5-yl)-phenylmethanone;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-amino-1,3-thiazol-5-yl)-phenylmethanone;ethane?
The IUPAC name of (2-amino-1,3-thiazol-5-yl)-phenylmethanone;ethane (CID 91203286) is (2-amino-1,3-thiazol-5-yl)-phenylmethanone;ethane.
What is the SMILES notation for (2-amino-1,3-thiazol-5-yl)-phenylmethanone;ethane?
The canonical SMILES for (2-amino-1,3-thiazol-5-yl)-phenylmethanone;ethane is CC.Nc1ncc(C(=O)c2ccccc2)s1.
What is the InChIKey of (2-amino-1,3-thiazol-5-yl)-phenylmethanone;ethane?
The InChIKey is LLYUITJRHZDEIW-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8N2OS.C2H6/c11-10-12-6-8(14-10)9(13)7-4-2-1-3-5-7;1-2/h1-6H,(H2,11,12);1-2H3.
What are the key properties of (2-amino-1,3-thiazol-5-yl)-phenylmethanone;ethane?
(2-amino-1,3-thiazol-5-yl)-phenylmethanone;ethane has a molecular weight of 234.32 g/mol, XLogP of 2.98, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2-amino-1,3-thiazol-5-yl)-phenylmethanone;ethane is sourced from PubChem (CID 91203286), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).