C22H21FN4O4 — CID 91203454
1-[[2-(2,6-dioxopiperidin-3-yl)-1-hydroxyisoindol-4-yl]methyl]-3-(3-fluorophenyl)-1-methylurea (PubChem CID 91203454) has the molecular formula C22H21FN4O4 and a molecular weight of 424.43 g/mol. Its IUPAC name is 1-[[2-(2,6-dioxopiperidin-3-yl)-1-hydroxyisoindol-4-yl]methyl]-3-(3-fluorophenyl)-1-methylurea.
| Compound Name | 1-[[2-(2,6-dioxopiperidin-3-yl)-1-hydroxyisoindol-4-yl]methyl]-3-(3-fluorophenyl)-1-methylurea |
|---|---|
| PubChem CID | 91203454 |
| Molecular Formula | C22H21FN4O4 |
| Molecular Weight | 424.43 g/mol |
| Exact Mass | 424.15 |
| IUPAC Name | 1-[[2-(2,6-dioxopiperidin-3-yl)-1-hydroxyisoindol-4-yl]methyl]-3-(3-fluorophenyl)-1-methylurea |
| SMILES | CN(Cc1cccc2c(O)n(C3CCC(=O)NC3=O)cc12)C(=O)Nc1cccc(F)c1 |
| InChI | InChI=1S/C22H21FN4O4/c1-26(22(31)24-15-6-3-5-14(23)10-15)11-13-4-2-7-16-17(13)12-27(21(16)30)18-8-9-19(28)25-20(18)29/h2-7,10,12,18,30H,8-9,11H2,1H3,(H,24,31)(H,25,28,29) |
| InChIKey | PJFXXAKNXMNRRX-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 103.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.43 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|