C26H24F20O2 — CID 91203700
[4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,11-heptadecafluoro-2-(3-tricyclo[6.2.1.02,7]undecanyl)undecan-2-yl] 2-(trifluoromethyl)prop-2-enoate (PubChem CID 91203700) has the molecular formula C26H24F20O2 and a molecular weight of 748.44 g/mol. Its IUPAC name is [4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,11-heptadecafluoro-2-(3-tricyclo[6.2.1.02,7]undecanyl)undecan-2-yl] 2-(trifluoromethyl)prop-2-enoate.
| Compound Name | [4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,11-heptadecafluoro-2-(3-tricyclo[6.2.1.02,7]undecanyl)undecan-2-yl] 2-(trifluoromethyl)prop-2-enoate |
|---|---|
| PubChem CID | 91203700 |
| Molecular Formula | C26H24F20O2 |
| Molecular Weight | 748.44 g/mol |
| Exact Mass | 748.15 |
| IUPAC Name | [4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,11-heptadecafluoro-2-(3-tricyclo[6.2.1.02,7]undecanyl)undecan-2-yl] 2-(trifluoromethyl)prop-2-enoate |
| SMILES | C=C(C(=O)OC(C)(CC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)C1CCCC2C3CCC(C3)C21)C(F)(F)F |
| InChI | InChI=1S/C26H24F20O2/c1-10(19(29,30)31)16(47)48-17(2,14-5-3-4-13-11-6-7-12(8-11)15(13)14)9-18(27,28)20(32,33)21(34,35)22(36,37)23(38,39)24(40,41)25(42,43)26(44,45)46/h11-15H,1,3-9H2,2H3 |
| InChIKey | VHAYXOXQXJQYFJ-UHFFFAOYSA-N |
| XLogP | 10.27 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 748.44 |
| LogP ≤ 5 | 10.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|