About 4-carboxyiminopentanoic acid
4-carboxyiminopentanoic acid (PubChem CID 91203926) has the molecular formula C6H9NO4
and a molecular weight of 159.14 g/mol. Its IUPAC name is 4-carboxyiminopentanoic acid.
Molecular Properties
| Compound Name | 4-carboxyiminopentanoic acid |
| PubChem CID | 91203926 |
| Molecular Formula | C6H9NO4 |
| Molecular Weight | 159.14 g/mol |
| Exact Mass | 159.05 |
| IUPAC Name | 4-carboxyiminopentanoic acid |
| SMILES | CC(CCC(=O)O)=NC(=O)O |
| InChI | InChI=1S/C6H9NO4/c1-4(7-6(10)11)2-3-5(8)9/h2-3H2,1H3,(H,8,9)(H,10,11) |
| InChIKey | JURCQCOLKGOKCV-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 86.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 159.14 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 4-carboxyiminopentanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-carboxyiminopentanoic acid?
The IUPAC name of 4-carboxyiminopentanoic acid (CID 91203926) is 4-carboxyiminopentanoic acid.
What is the SMILES notation for 4-carboxyiminopentanoic acid?
The canonical SMILES for 4-carboxyiminopentanoic acid is CC(CCC(=O)O)=NC(=O)O.
What is the InChIKey of 4-carboxyiminopentanoic acid?
The InChIKey is JURCQCOLKGOKCV-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H9NO4/c1-4(7-6(10)11)2-3-5(8)9/h2-3H2,1H3,(H,8,9)(H,10,11).
What are the key properties of 4-carboxyiminopentanoic acid?
4-carboxyiminopentanoic acid has a molecular weight of 159.14 g/mol, XLogP of 0.99, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-carboxyiminopentanoic acid is sourced from PubChem (CID 91203926), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).