C11H16F6N2O — CID 91203975
aniline;1,1,1,3,3,3-hexafluoro-2-methylpropan-2-ol;methanamine (PubChem CID 91203975) has the molecular formula C11H16F6N2O and a molecular weight of 306.25 g/mol. Its IUPAC name is aniline;1,1,1,3,3,3-hexafluoro-2-methylpropan-2-ol;methanamine.
| Compound Name | aniline;1,1,1,3,3,3-hexafluoro-2-methylpropan-2-ol;methanamine |
|---|---|
| PubChem CID | 91203975 |
| Molecular Formula | C11H16F6N2O |
| Molecular Weight | 306.25 g/mol |
| Exact Mass | 306.12 |
| IUPAC Name | aniline;1,1,1,3,3,3-hexafluoro-2-methylpropan-2-ol;methanamine |
| SMILES | CC(O)(C(F)(F)F)C(F)(F)F.CN.Nc1ccccc1 |
| InChI | InChI=1S/C6H7N.C4H4F6O.CH5N/c7-6-4-2-1-3-5-6;1-2(11,3(5,6)7)4(8,9)10;1-2/h1-5H,7H2;11H,1H3;2H2,1H3 |
| InChIKey | KNGFOSIZWPQKGW-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 72.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.25 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|